Compound Q&A

What industries use Benzene-d6 (CAS: 1076-43-3)?

Answer

Benzene-d6
Benzene-d6 is primarily used in the field of analytical chemistry, particularly in nuclear magnetic resonance (NMR) spectroscopy. It serves as an internal standard in NMR analysis, aiding in the accurate measurement of chemical shifts. Additionally, it has applications in the pharmaceutical industry for quality control and in the semiconductor industry for precise chemical analysis.

About

CAS No 1076-43-3
English Name Benzene-d6
Molecular Formula C6D6
Molecular Weight 84.15 g/mol
SMILES c1([2H])c([2H])c([2H])c(c(c1[2H])[2H])[2H]
InChIKey UHOVQNZJYSORNB-MZWXYZOWSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzene-d6 (CAS: 1076-43-3)?

Benzene-d6 is a colorless liquid with a molecular weight of 114.17 g/mol. It has a low solubility in...

Compound Q&A

How is Benzene-d6 (CAS: 1076-43-3) typically synthesized?

Benzene-d6 is synthesized by deuterium labeling of benzene. The reaction involves the replacement of...

Compound Q&A

What precautions should be taken when handling Benzene-d6 (CAS: 1076-43-3)?

Benzene-d6 should be handled with caution due to its flammability and potential health effects. Lab ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...