Compound Q&A

What are the physical and chemical properties of Benzene-d6 (CAS: 1076-43-3)?

Answer

Benzene-d6
Benzene-d6 is a colorless liquid with a molecular weight of 114.17 g/mol. It has a low solubility in water but is highly soluble in organic solvents. This compound is less reactive than benzene due to the deuterium substitution. Benzene-d6 exhibits a high boiling point and is flammable. It is often used in NMR spectroscopy as an internal standard.

About

CAS No 1076-43-3
English Name Benzene-d6
Molecular Formula C6D6
Molecular Weight 84.15 g/mol
SMILES c1([2H])c([2H])c([2H])c(c(c1[2H])[2H])[2H]
InChIKey UHOVQNZJYSORNB-MZWXYZOWSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Benzene-d6 (CAS: 1076-43-3) typically synthesized?

Benzene-d6 is synthesized by deuterium labeling of benzene. The reaction involves the replacement of...

Compound Q&A

What industries use Benzene-d6 (CAS: 1076-43-3)?

Benzene-d6 is primarily used in the field of analytical chemistry, particularly in nuclear magnetic ...

Compound Q&A

What precautions should be taken when handling Benzene-d6 (CAS: 1076-43-3)?

Benzene-d6 should be handled with caution due to its flammability and potential health effects. Lab ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...