Compound Q&A

What industries use 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

Answer

2,4,5-Trifluorobenzoyl chloride
2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) is primarily used in the pharmaceutical and polymer industries. It serves as a key building block for the synthesis of various fluorinated compounds, which are important in drug design and development. Additionally, it is used in the production of fluorinated polymers for electronic and optical applications.

About

CAS No 88419-56-1
English Name 2,4,5-Trifluorobenzoyl chloride
Molecular Formula C7H2ClF3O
Molecular Weight 194.539 g/mol
SMILES C1=C(C(=CC(=C1F)F)F)C(=O)Cl
InChIKey STBGCAUUOPNJBH-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) typically synthesized?

2,4,5-Trifluorobenzoyl chloride is typically synthesized by the chlorination of 2,4,5-trifluorobenzo...

Compound Q&A

What precautions should be taken when handling 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

When handling 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1), it is essential to use appropriate ...

Compound Q&A

What is 2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0)?

2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0) is a benzoic acid derivativ...

16611-84-02-Hydroxy-6-pentadec...
Compound Q&A

What are the main uses of 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4) is primarily use...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)?

1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)...

105637-50-11-[(5-Chloro-1-napht...
Compound Q&A

What regulatory guidelines apply to 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6)?

1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6) is regulated u...

28523-86-61,1,1,3,3,3-Hexafluo...