Compound Q&A

What are the physical and chemical properties of 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

Answer

2,4,5-Trifluorobenzoyl chloride
2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) is a white crystalline solid with a molecular weight of 239.12 g/mol. It has low solubility in water but is soluble in organic solvents like dichloromethane and ethanol. This compound is highly reactive and prone to nucleophilic substitution reactions. It is a potent electrophile and is used in organic synthesis.

About

CAS No 88419-56-1
English Name 2,4,5-Trifluorobenzoyl chloride
Molecular Formula C7H2ClF3O
Molecular Weight 194.539 g/mol
SMILES C1=C(C(=CC(=C1F)F)F)C(=O)Cl
InChIKey STBGCAUUOPNJBH-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) typically synthesized?

2,4,5-Trifluorobenzoyl chloride is typically synthesized by the chlorination of 2,4,5-trifluorobenzo...

Compound Q&A

What industries use 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) is primarily used in the pharmaceutical and polyme...

Compound Q&A

What precautions should be taken when handling 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

When handling 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1), it is essential to use appropriate ...

Compound Q&A

What is 2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0)?

2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0) is a benzoic acid derivativ...

16611-84-02-Hydroxy-6-pentadec...
Compound Q&A

What are the main uses of 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4) is primarily use...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)?

1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)...

105637-50-11-[(5-Chloro-1-napht...
Compound Q&A

What regulatory guidelines apply to 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6)?

1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6) is regulated u...

28523-86-61,1,1,3,3,3-Hexafluo...