Compound Q&A

How is 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) typically synthesized?

Answer

2,4,5-Trifluorobenzoyl chloride
2,4,5-Trifluorobenzoyl chloride is typically synthesized by the chlorination of 2,4,5-trifluorobenzoic acid in the presence of thionyl chloride. This process involves the use of a catalytic amount of thionyl chloride to facilitate the introduction of the chlorine atom at the benzylic position. The reaction is carried out under anhydrous conditions to minimize side reactions.

About

CAS No 88419-56-1
English Name 2,4,5-Trifluorobenzoyl chloride
Molecular Formula C7H2ClF3O
Molecular Weight 194.539 g/mol
SMILES C1=C(C(=CC(=C1F)F)F)C(=O)Cl
InChIKey STBGCAUUOPNJBH-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1) is primarily used in the pharmaceutical and polyme...

Compound Q&A

What precautions should be taken when handling 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1)?

When handling 2,4,5-Trifluorobenzoyl chloride (CAS: 88419-56-1), it is essential to use appropriate ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...