Compound Q&A

What precautions should be taken when handling (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5)?

Answer

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
When handling (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione, it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure. Spills should be handled using appropriate absorbent materials, and the area should be cleaned thoroughly. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 115-27-5
English Name (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
Molecular Formula C9H2Cl6O3
Molecular Weight 370.83 g/mol
SMILES C12C(C(=O)OC1=O)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl
InChIKey FLBJFXNAEMSXGL-SBUZQEQSSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5)?

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione is a crystalline com...

Compound Q&A

How is (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5) typically synthesized?

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione is synthesized throu...

Compound Q&A

What industries use (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5)?

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione is primarily used in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...