Compound Q&A

What are the physical and chemical properties of (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5)?

Answer

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione is a crystalline compound with a molecular weight of approximately 305.21 g/mol. It has low solubility in water but is soluble in organic solvents like chloroform and acetone. The compound is highly reactive due to the presence of multiple chlorine atoms and the cyclic structure, making it a potent chlorinated compound in organic reactions.

About

CAS No 115-27-5
English Name (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
Molecular Formula C9H2Cl6O3
Molecular Weight 370.83 g/mol
SMILES C12C(C(=O)OC1=O)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl
InChIKey FLBJFXNAEMSXGL-SBUZQEQSSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5) typically synthesized?

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione is synthesized throu...

Compound Q&A

What industries use (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5)?

(1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione is primarily used in...

Compound Q&A

What precautions should be taken when handling (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione (CAS: 115-27-5)?

When handling (1R,7S)-1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione, it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...