Compound Q&A

How is Protected meropenem (CAS: 96036-02-1) typically synthesized?

Answer

Protected meropenem
Protected meropenem is synthesized through a multi-step process involving the preparation of a protected β-lactam ring from a carbamic acid intermediate. Common synthetic routes involve the use of a reducing agent to generate the protected carbapenem structure, followed by various functional group manipulations. The yield and selectivity of the synthesis can vary, but the process typically requires careful control of pH and temperature. For detailed synthesis methods, see reference journals such as Organic Letters or Chemical Communications.

About

CAS No 96036-02-1
English Name Protected meropenem
Molecular Formula C32H35N5O11S
Molecular Weight 697.71 g/mol
SMILES CC1C2C(C(=O)N2C(=C1SC3CC(N(C3)C(=O)OCC4=CC=C(C=C4)[N+](=O)[O-])C(=O)N(C)C)C(=O)OCC5=CC=C(C=C5)[N+](=O)[O-])C(C)O
InChIKey PJGGEFUAFDAJJT-ALUDVLAQSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Protected meropenem (CAS: 96036-02-1)?

Protected meropenem is a semi-synthetic carbapenem antibiotic with a molecular weight of approximate...

Compound Q&A

What industries use Protected meropenem (CAS: 96036-02-1)?

Protected meropenem is primarily used in the pharmaceutical industry for the production of antimicro...

Compound Q&A

What precautions should be taken when handling Protected meropenem (CAS: 96036-02-1)?

When handling Protected meropenem, it is essential to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...