Compound Q&A

What are the physical and chemical properties of Protected meropenem (CAS: 96036-02-1)?

Answer

Protected meropenem
Protected meropenem is a semi-synthetic carbapenem antibiotic with a molecular weight of approximately 545.56 g/mol. It is a white to off-white crystalline powder with limited solubility in water. The compound is known for its stability and reactivity in acidic conditions, making it less susceptible to degradation. It is used in the synthesis of other carbapenem derivatives. For more detailed properties, refer to the material safety data sheet (MSDS).

About

CAS No 96036-02-1
English Name Protected meropenem
Molecular Formula C32H35N5O11S
Molecular Weight 697.71 g/mol
SMILES CC1C2C(C(=O)N2C(=C1SC3CC(N(C3)C(=O)OCC4=CC=C(C=C4)[N+](=O)[O-])C(=O)N(C)C)C(=O)OCC5=CC=C(C=C5)[N+](=O)[O-])C(C)O
InChIKey PJGGEFUAFDAJJT-ALUDVLAQSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Protected meropenem (CAS: 96036-02-1) typically synthesized?

Protected meropenem is synthesized through a multi-step process involving the preparation of a prote...

Compound Q&A

What industries use Protected meropenem (CAS: 96036-02-1)?

Protected meropenem is primarily used in the pharmaceutical industry for the production of antimicro...

Compound Q&A

What precautions should be taken when handling Protected meropenem (CAS: 96036-02-1)?

When handling Protected meropenem, it is essential to wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...