Compound Q&A

How is Ioversol (CAS: 87771-40-2) typically synthesized?

Answer

Ioversol
Ioversol is synthesized through a multi-step process involving the reaction of benzyl alcohol with iodine, followed by a series of coupling reactions and derivatization. The process requires the use of catalysts and solvents, with high selectivity and yield, leading to the formation of the desired product. The final step involves purifying the compound to ensure high purity.

About

CAS No 87771-40-2
English Name Ioversol
Molecular Formula C18H24I3N3O9
Molecular Weight 807.11 g/mol
SMILES C(CO)N(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO
InChIKey AMDBBAQNWSUWGN-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ioversol (CAS: 87771-40-2)?

Ioversol is a water-soluble, nonionic contrast agent with a molecular weight of approximately 578.69...

Compound Q&A

What industries use Ioversol (CAS: 87771-40-2)?

Ioversol is primarily used in the healthcare industry, particularly in radiology and cardiology depa...

Compound Q&A

What precautions should be taken when handling Ioversol (CAS: 87771-40-2)?

When handling Ioversol, it is essential to wear appropriate personal protective equipment (PPE) incl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...