Compound Q&A

What are the physical and chemical properties of Ioversol (CAS: 87771-40-2)?

Answer

Ioversol
Ioversol is a water-soluble, nonionic contrast agent with a molecular weight of approximately 578.69 g/mol. It is highly soluble in water and has low reactivity. Ioversol forms a crystalline structure, making it stable under normal storage conditions. It is commonly used in medical imaging due to its low toxicity and ability to enhance image contrast.

About

CAS No 87771-40-2
English Name Ioversol
Molecular Formula C18H24I3N3O9
Molecular Weight 807.11 g/mol
SMILES C(CO)N(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO
InChIKey AMDBBAQNWSUWGN-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Ioversol (CAS: 87771-40-2) typically synthesized?

Ioversol is synthesized through a multi-step process involving the reaction of benzyl alcohol with i...

Compound Q&A

What industries use Ioversol (CAS: 87771-40-2)?

Ioversol is primarily used in the healthcare industry, particularly in radiology and cardiology depa...

Compound Q&A

What precautions should be taken when handling Ioversol (CAS: 87771-40-2)?

When handling Ioversol, it is essential to wear appropriate personal protective equipment (PPE) incl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...