Compound Q&A

What industries use (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1)?

Answer

(4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1)
This compound is used in the pharmaceutical industry for its potential as an intermediate in drug synthesis. It is also utilized in the polymer industry as a monomer for the production of various polymers and in the sensor industry for its sensing properties. Additionally, it can be applied in semiconductor manufacturing due to its unique chemical structure.

About

CAS No 84696-15-1
English Name (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1)
Molecular Formula C35H52O6
Molecular Weight 568.8 g/mol
SMILES COC1C=C(CCC(=O)CC(C)CCCCC)C=CC=1O.COC1C=C(CCC(=O)/C=C/CCCCC)C=CC=1O
InChIKey QCVRFSPGUWEKFC-ILHSMLOTSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1)?

This compound is a crystalline solid with a molecular weight of approximately 286.35 g/mol. It is sl...

Compound Q&A

How is (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1) typically synthesized?

This compound is synthesized via a condensation reaction between 4-hydroxy-3-methoxyacetophenone and...

Compound Q&A

What precautions should be taken when handling (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1)?

When handling this compound, ensure the use of personal protective equipment (PPE) such as gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...