Compound Q&A

What are the physical and chemical properties of (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1)?

Answer

(4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1)
This compound is a crystalline solid with a molecular weight of approximately 286.35 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it exhibits moderate reactivity with common nucleophiles and electrophiles. It has a melting point around 50-55°C and a boiling point of about 250°C. It is sensitive to light and air, making it necessary to store it in a well-sealed container.

About

CAS No 84696-15-1
English Name (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1)
Molecular Formula C35H52O6
Molecular Weight 568.8 g/mol
SMILES COC1C=C(CCC(=O)CC(C)CCCCC)C=CC=1O.COC1C=C(CCC(=O)/C=C/CCCCC)C=CC=1O
InChIKey QCVRFSPGUWEKFC-ILHSMLOTSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1) typically synthesized?

This compound is synthesized via a condensation reaction between 4-hydroxy-3-methoxyacetophenone and...

Compound Q&A

What industries use (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1)?

This compound is used in the pharmaceutical industry for its potential as an intermediate in drug sy...

Compound Q&A

What precautions should be taken when handling (4E)-1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one - 1-(4-hydroxy-3-methoxyphenyl)-5-methyl-3-decanone (1:1) (CAS: 84696-15-1)?

When handling this compound, ensure the use of personal protective equipment (PPE) such as gloves, g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...