Compound Q&A

What precautions should be taken when handling Umeclidinium Bromide (CAS: 869113-09-7)?

Answer

Umeclidinium Bromide
When handling Umeclidinium bromide (CAS: 869113-09-7), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate techniques, and the material safety data sheet (MSDS) should be consulted for specific guidelines.

About

English Name Umeclidinium Bromide
Molecular Formula C29H34BrNO2
Molecular Weight 508.49 g/mol
SMILES [Br-].OC(c1ccccc1)(c2ccccc2)C3(CC[N+]4(CCOCc5ccccc5)CC3)CC4
InChIKey PEJHHXHHNGORMP-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Umeclidinium Bromide (CAS: 869113-09-7)?

Umeclidinium bromide is a white to off-white crystalline powder (CAS: 869113-09-7). Its molecular we...

Compound Q&A

How is Umeclidinium Bromide (CAS: 869113-09-7) typically synthesized?

Umeclidinium bromide is synthesized by reacting umeclidinium chloride with bromine in the presence o...

Compound Q&A

What industries use Umeclidinium Bromide (CAS: 869113-09-7)?

Umeclidinium bromide (CAS: 869113-09-7) is primarily used in the pharmaceutical industry for the tre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...