Compound Q&A

How is Umeclidinium Bromide (CAS: 869113-09-7) typically synthesized?

Answer

Umeclidinium Bromide
Umeclidinium bromide is synthesized by reacting umeclidinium chloride with bromine in the presence of an organic solvent. This reaction is highly selective and yields a high percentage of the desired product. The process involves careful temperature control and purification steps to obtain a high-purity crystalline product.

About

English Name Umeclidinium Bromide
Molecular Formula C29H34BrNO2
Molecular Weight 508.49 g/mol
SMILES [Br-].OC(c1ccccc1)(c2ccccc2)C3(CC[N+]4(CCOCc5ccccc5)CC3)CC4
InChIKey PEJHHXHHNGORMP-UHFFFAOYSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Umeclidinium Bromide (CAS: 869113-09-7)?

Umeclidinium bromide is a white to off-white crystalline powder (CAS: 869113-09-7). Its molecular we...

Compound Q&A

What industries use Umeclidinium Bromide (CAS: 869113-09-7)?

Umeclidinium bromide (CAS: 869113-09-7) is primarily used in the pharmaceutical industry for the tre...

Compound Q&A

What precautions should be taken when handling Umeclidinium Bromide (CAS: 869113-09-7)?

When handling Umeclidinium bromide (CAS: 869113-09-7), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...