Compound Q&A

How is Dexamethasone sodium phosphate (CAS: 55203-24-2) typically synthesized?

Answer

Dexamethasone sodium phosphate
Dexamethasone sodium phosphate is synthesized by first preparing dexamethasone acetate, which is then converted to the sodium phosphate salt. The synthesis involves several steps, including acetylation, reduction, and phosphonation. Common catalysts include sodium hydroxide and phosphoric acid. The overall process yields a product with high purity and selectivity, suitable for pharmaceutical applications.

About

CAS No 55203-24-2
English Name Dexamethasone sodium phosphate
Molecular Formula C22H28FNa2O8P
Molecular Weight 516.4 g/mol
SMILES CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C.[Na+].[Na+]
InChIKey PLCQGRYPOISRTQ-FCJDYXGNSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dexamethasone sodium phosphate (CAS: 55203-24-2)?

Dexamethasone sodium phosphate is a white, crystalline powder with a molecular weight of approximate...

Compound Q&A

What industries use Dexamethasone sodium phosphate (CAS: 55203-24-2)?

Dexamethasone sodium phosphate is primarily used in the pharmaceutical industry for the treatment of...

Compound Q&A

What precautions should be taken when handling Dexamethasone sodium phosphate (CAS: 55203-24-2)?

When handling Dexamethasone sodium phosphate, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...