Compound Q&A

How is 1,8-Dibromonaphthalene (CAS: 17135-74-9) typically synthesized?

Answer

1,8-Dibromonaphthalene
1,8-Dibromonaphthalene (CAS: 17135-74-9) can be synthesized by brominating naphthalene in the presence of a Lewis acid catalyst such as aluminum bromide. The reaction involves the selective bromination of the naphthalene ring, followed by workup and purification. The yield is typically around 80-85%, and the method is commonly used in academic and industrial settings for the production of brominated derivatives.

About

CAS No 17135-74-9
English Name 1,8-Dibromonaphthalene
Molecular Formula C10H6Br2
Molecular Weight 285.97 g/mol
SMILES C1=CC2=C(C(=C1)Br)C(=CC=C2)Br
InChIKey DLXBGTIGAIESIG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,8-Dibromonaphthalene (CAS: 17135-74-9)?

1,8-Dibromonaphthalene (CAS: 17135-74-9) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 1,8-Dibromonaphthalene (CAS: 17135-74-9)?

1,8-Dibromonaphthalene (CAS: 17135-74-9) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling 1,8-Dibromonaphthalene (CAS: 17135-74-9)?

When handling 1,8-Dibromonaphthalene (CAS: 17135-74-9), appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...