Compound Q&A

What are the physical and chemical properties of 1,8-Dibromonaphthalene (CAS: 17135-74-9)?

Answer

1,8-Dibromonaphthalene
1,8-Dibromonaphthalene (CAS: 17135-74-9) is a crystalline solid with a molecular weight of approximately 270.07 g/mol. It has a high melting point of 222–224 °C and is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is less reactive than naphthalene but can undergo electrophilic substitution reactions. It is commonly used as a starting material in organic synthesis and as a halogenated aromatic compound in various applications.

About

CAS No 17135-74-9
English Name 1,8-Dibromonaphthalene
Molecular Formula C10H6Br2
Molecular Weight 285.97 g/mol
SMILES C1=CC2=C(C(=C1)Br)C(=CC=C2)Br
InChIKey DLXBGTIGAIESIG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1,8-Dibromonaphthalene (CAS: 17135-74-9) typically synthesized?

1,8-Dibromonaphthalene (CAS: 17135-74-9) can be synthesized by brominating naphthalene in the presen...

Compound Q&A

What industries use 1,8-Dibromonaphthalene (CAS: 17135-74-9)?

1,8-Dibromonaphthalene (CAS: 17135-74-9) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling 1,8-Dibromonaphthalene (CAS: 17135-74-9)?

When handling 1,8-Dibromonaphthalene (CAS: 17135-74-9), appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...