Compound Q&A

What industries use 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2)?

Answer

2-Amino-3,5-dimethylbenzenesulfonic acid
2-Amino-3,5-dimethylbenzenesulfonic acid is widely used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also utilized in the polymer industry as a functional monomer, in the sensor industry for detecting specific analytes, and in the semiconductor industry for etching and cleaning processes.

About

CAS No 88-22-2
English Name 2-Amino-3,5-dimethylbenzenesulfonic acid
Molecular Formula C8H11NO3S
Molecular Weight 201.25 g/mol
SMILES CC1=CC(=C(C(=C1)S(=O)(=O)O)N)C
InChIKey CFCXQQUQLZIZPI-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2)?

2-Amino-3,5-dimethylbenzenesulfonic acid is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2) typically synthesized?

2-Amino-3,5-dimethylbenzenesulfonic acid is commonly synthesized by reacting 3,5-dimethylbenzenesulf...

Compound Q&A

What precautions should be taken when handling 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2)?

When handling 2-Amino-3,5-dimethylbenzenesulfonic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...