Compound Q&A

How is 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2) typically synthesized?

Answer

2-Amino-3,5-dimethylbenzenesulfonic acid
2-Amino-3,5-dimethylbenzenesulfonic acid is commonly synthesized by reacting 3,5-dimethylbenzenesulfonic acid with ammonia. This process involves the substitution of a hydrogen atom on the sulfonic acid group with an amino group. The reaction is typically carried out in the presence of a catalyst such as p-toluenesulfonic acid to enhance selectivity and yield.

About

CAS No 88-22-2
English Name 2-Amino-3,5-dimethylbenzenesulfonic acid
Molecular Formula C8H11NO3S
Molecular Weight 201.25 g/mol
SMILES CC1=CC(=C(C(=C1)S(=O)(=O)O)N)C
InChIKey CFCXQQUQLZIZPI-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2)?

2-Amino-3,5-dimethylbenzenesulfonic acid is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2)?

2-Amino-3,5-dimethylbenzenesulfonic acid is widely used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 2-Amino-3,5-dimethylbenzenesulfonic acid (CAS: 88-22-2)?

When handling 2-Amino-3,5-dimethylbenzenesulfonic acid, it is essential to wear appropriate personal...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...