Compound Q&A

How is Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4) typically synthesized?

Answer

Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (1:1)
Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4) is typically synthesized by reacting 4-hydroxyacetophenone with methylamine in the presence of a catalytic amount of a chiral resolving agent, such as (S)-(-)-1-phenylethanol. The reaction mixture is then treated with hydrochloric acid to form the hydrochloride salt. The process achieves high selectivity and yields around 90% of the desired enantiomer.

About

CAS No 57591-61-4
English Name Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (1:1)
Molecular Formula C9H12ClNO3
Molecular Weight 217.65 g/mol
SMILES COC(=O)C(C1=CC=C(C=C1)O)N.Cl
InChIKey UYCKVJUNDXPDJH-DDWIOCJRSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4)?

Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4) is a crystalline white pow...

Compound Q&A

What industries use Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4)?

Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4)?

When handling Methyl (2R)-amino(4-hydroxyphenyl)acetate hydrochloride (CAS: 57591-61-4), it is impor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...