Compound Q&A

How is 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5) typically synthesized?

Answer

3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid
3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid can be synthesized through a multi-step process involving the condensation of 2,2-dimethylpropionaldehyde with 4-hydroxy-3,5-dimethylphenol, followed by an esterification reaction. This compound is often obtained using mild conditions, with catalysts such as sulfuric acid or p-toluenesulfonic acid, to achieve a yield of about 75-80%.

About

CAS No 20170-32-5
English Name 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid
Molecular Formula C17H26O3
Molecular Weight 278.39 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)O
InChIKey WPMYUUITDBHVQZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5)?

3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid is a crystalline solid with a molecul...

Compound Q&A

What industries use 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5)?

3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5)?

Proper handling of 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid requires the use o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...