Compound Q&A

What are the physical and chemical properties of 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5)?

Answer

3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid
3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid is a crystalline solid with a molecular weight of approximately 346.45 g/mol. It has a pKa of ~5.3, indicating it is slightly acidic. The compound is poorly soluble in water but soluble in common organic solvents like dichloromethane and ethanol. It exhibits good reactivity towards nucleophiles and can undergo esterification and condensation reactions.

About

CAS No 20170-32-5
English Name 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid
Molecular Formula C17H26O3
Molecular Weight 278.39 g/mol
SMILES CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)O
InChIKey WPMYUUITDBHVQZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5) typically synthesized?

3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid can be synthesized through a multi-st...

Compound Q&A

What industries use 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5)?

3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid (CAS: 20170-32-5)?

Proper handling of 3-[4-Hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoic acid requires the use o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...