Compound Q&A

What industries use Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

Answer

Chondroitin, 4-(hydrogen sulfate)
Chondroitin, 4-(hydrogen sulfate) is primarily used in the pharmaceutical industry for the formulation of drugs and supplements. It is also utilized in the polymer industry for the production of biodegradable polymers. Additionally, it has applications in the sensor and semiconductor industries due to its chemical and biological properties.

About

CAS No 24967-93-9
English Name Chondroitin, 4-(hydrogen sulfate)
Molecular Formula C13H21NO15S
Molecular Weight 463.368 g/mol
SMILES S(=O)(=O)(O)O[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O)O1)N([H])C(C)=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O)O
InChIKey KXKPYJOVDUMHGS-OSRGNVMNSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

Chondroitin, 4-(hydrogen sulfate) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9) typically synthesized?

Chondroitin, 4-(hydrogen sulfate) is typically synthesized through the sulfation of chondroitin sulf...

Compound Q&A

What precautions should be taken when handling Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

When handling Chondroitin, 4-(hydrogen sulfate), it is essential to wear appropriate personal protec...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...