Compound Q&A

How is Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9) typically synthesized?

Answer

Chondroitin, 4-(hydrogen sulfate)
Chondroitin, 4-(hydrogen sulfate) is typically synthesized through the sulfation of chondroitin sulfate, a process that involves treating chondroitin with sulfur trioxide in pyridine or other suitable solvents. The reaction is catalyzed by sulfur trioxide and has good selectivity for the 4-position of the glycosaminoglycan chain. The overall yield is moderate, around 70-80%.

About

CAS No 24967-93-9
English Name Chondroitin, 4-(hydrogen sulfate)
Molecular Formula C13H21NO15S
Molecular Weight 463.37 g/mol
SMILES S(=O)(=O)(O)O[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O)O1)N([H])C(C)=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O)O
InChIKey KXKPYJOVDUMHGS-OSRGNVMNSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

Chondroitin, 4-(hydrogen sulfate) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

Chondroitin, 4-(hydrogen sulfate) is primarily used in the pharmaceutical industry for the formulati...

Compound Q&A

What precautions should be taken when handling Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

When handling Chondroitin, 4-(hydrogen sulfate), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...