Compound Q&A

How is Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9) typically synthesized?

Answer

Chondroitin, 4-(hydrogen sulfate)
Chondroitin, 4-(hydrogen sulfate) is typically synthesized through the sulfation of chondroitin sulfate, a process that involves treating chondroitin with sulfur trioxide in pyridine or other suitable solvents. The reaction is catalyzed by sulfur trioxide and has good selectivity for the 4-position of the glycosaminoglycan chain. The overall yield is moderate, around 70-80%.

About

CAS No 24967-93-9
English Name Chondroitin, 4-(hydrogen sulfate)
Molecular Formula C13H21NO15S
Molecular Weight 463.368 g/mol
SMILES S(=O)(=O)(O)O[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O)O1)N([H])C(C)=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O)O
InChIKey KXKPYJOVDUMHGS-OSRGNVMNSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

Chondroitin, 4-(hydrogen sulfate) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

Chondroitin, 4-(hydrogen sulfate) is primarily used in the pharmaceutical industry for the formulati...

Compound Q&A

What precautions should be taken when handling Chondroitin, 4-(hydrogen sulfate) (CAS: 24967-93-9)?

When handling Chondroitin, 4-(hydrogen sulfate), it is essential to wear appropriate personal protec...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...