Compound Q&A

How is 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4) typically synthesized?

Answer

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione
2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4) is typically synthesized via a multistep process starting from 2-quinolinylindene. Key steps include the formation of the quinoline ring, followed by the introduction of the hydroxy group and the indene ring closure. Commonly used catalysts in the synthesis include palladium complexes. The overall yield is moderate, around 50-60%, and selectivity is high for the desired product.

About

CAS No 75216-45-4
English Name 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione
Molecular Formula C18H11NO3
Molecular Weight 289.29 g/mol
SMILES c1ccc2c(c1)cc(c(n2)C3C(=O)c4ccccc4C3=O)O
InChIKey FDTLQXNAPKJJAM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4)?

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4) is a solid with a crystalline f...

Compound Q&A

What industries use 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4)?

2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4)?

When handling 2-(3-Hydroxy-2-quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 75216-45-4), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...