Compound Q&A

How is (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) typically synthesized?

Answer

{4-[(4-Methylbenzyl)oxy]phenyl}methanol
(4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) can be synthesized via a two-step process. First, 4-hydroxybenzyl alcohol is treated with 4-methylbenzyl chloride to form the ether, followed by oxidation using sodium hypochlorite to introduce the hydroxyl group. The overall reaction is selective and yields a high percentage of the desired product, though careful handling of reagents is required to avoid side reactions.

About

English Name {4-[(4-Methylbenzyl)oxy]phenyl}methanol
Molecular Formula C15H16O2
Molecular Weight 228.29 g/mol
SMILES CC1=CC=C(C=C1)COC2=CC=C(C=C2)CO
InChIKey NERFNHBZJXXFGY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4)?

(4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) is a white crystalline solid with a molec...

Compound Q&A

What industries use (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4)?

(4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4)?

Proper handling of (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) requires the use of pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...