Compound Q&A

What are the physical and chemical properties of (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4)?

Answer

{4-[(4-Methylbenzyl)oxy]phenyl}methanol
(4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) is a white crystalline solid with a molecular weight of approximately 282.34 g/mol. It has a moderate solubility in water and is soluble in organic solvents like ethanol and acetone. Chemically, it exhibits limited reactivity but can undergo substitution reactions under specific conditions. It is stable under normal storage conditions but requires protection from light.

About

English Name {4-[(4-Methylbenzyl)oxy]phenyl}methanol
Molecular Formula C15H16O2
Molecular Weight 228.29 g/mol
SMILES CC1=CC=C(C=C1)COC2=CC=C(C=C2)CO
InChIKey NERFNHBZJXXFGY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) typically synthesized?

(4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) can be synthesized via a two-step process...

Compound Q&A

What industries use (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4)?

(4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4)?

Proper handling of (4-[(4-Methylbenzyl)oxy]phenyl)methanol (CAS: 201058-08-4) requires the use of pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...