Compound Q&A

What industries use Bithionol (CAS: 97-18-7)?

Answer

Bithionol
Bithionol (CAS: 97-18-7) is primarily used in the agricultural industry as a fungicide. It is also employed in the pharmaceutical industry for its antimicrobial properties and in the chemical industry for its fungicidal activity. Additionally, it can be used in the formulation of paints and coatings.

About

CAS No 97-18-7
English Name Bithionol
Molecular Formula C12H6Cl4O2S
Molecular Weight 356.06 g/mol
SMILES C1=C(C=C(C(=C1SC2=C(C(=CC(=C2)Cl)Cl)O)O)Cl)Cl
InChIKey JFIOVJDNOJYLKP-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bithionol (CAS: 97-18-7)?

Bithionol (CAS: 97-18-7) is a crystalline solid with a molecular weight of approximately 174.24 g/mo...

Compound Q&A

How is Bithionol (CAS: 97-18-7) typically synthesized?

Bithionol (CAS: 97-18-7) is synthesized by the reaction of aniline with dichloromethane in the prese...

Compound Q&A

What precautions should be taken when handling Bithionol (CAS: 97-18-7)?

When handling Bithionol (CAS: 97-18-7), it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...