Compound Q&A

What are the physical and chemical properties of Bithionol (CAS: 97-18-7)?

Answer

Bithionol
Bithionol (CAS: 97-18-7) is a crystalline solid with a molecular weight of approximately 174.24 g/mol. It has a high melting point and exhibits low solubility in water but is soluble in organic solvents. Chemically, it is relatively stable but can react with strong bases. Bithionol is used as a fungicide and has good fungicidal activity.

About

CAS No 97-18-7
English Name Bithionol
Molecular Formula C12H6Cl4O2S
Molecular Weight 356.06 g/mol
SMILES C1=C(C=C(C(=C1SC2=C(C(=CC(=C2)Cl)Cl)O)O)Cl)Cl
InChIKey JFIOVJDNOJYLKP-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Bithionol (CAS: 97-18-7) typically synthesized?

Bithionol (CAS: 97-18-7) is synthesized by the reaction of aniline with dichloromethane in the prese...

Compound Q&A

What industries use Bithionol (CAS: 97-18-7)?

Bithionol (CAS: 97-18-7) is primarily used in the agricultural industry as a fungicide. It is also e...

Compound Q&A

What precautions should be taken when handling Bithionol (CAS: 97-18-7)?

When handling Bithionol (CAS: 97-18-7), it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...