Compound Q&A

What industries use dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2)?

Answer

dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate
Dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the development of advanced polymers and sensors due to its unique reactivity and structural properties.

About

CAS No 12007-60-2
English Name dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate
Molecular Formula B4Li2O7
Molecular Weight 169.2 g/mol
SMILES [Li+].[Li+].B(=O)OB([O-])OB([O-])OB=O
InChIKey PSHMSSXLYVAENJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2)?

Dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate is a crystalline compound with a m...

Compound Q&A

How is dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2) typically synthesized?

This compound is typically synthesized via a multi-step process involving boronation and nucleophili...

Compound Q&A

What precautions should be taken when handling dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2)?

When handling dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate, it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...