Compound Q&A

What are the physical and chemical properties of dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2)?

Answer

dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate
Dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate is a crystalline compound with a molecular weight of approximately 100.16 g/mol. It has poor solubility in common organic solvents but is soluble in polar solvents. It is highly reactive, particularly towards acids and nucleophiles, making it susceptible to hydrolysis and other chemical transformations.

About

CAS No 12007-60-2
English Name dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate
Molecular Formula B4Li2O7
Molecular Weight 169.2 g/mol
SMILES [Li+].[Li+].B(=O)OB([O-])OB([O-])OB=O
InChIKey PSHMSSXLYVAENJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2) typically synthesized?

This compound is typically synthesized via a multi-step process involving boronation and nucleophili...

Compound Q&A

What industries use dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2)?

Dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate is primarily used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate (CAS: 12007-60-2)?

When handling dilithium;[oxido(oxoboranyloxy)boranyl]oxy-oxoboranyloxy-borinate, it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...