Compound Q&A

What precautions should be taken when handling Cobalt(2+) disulfamate (CAS: 14017-41-5)?

Answer

Cobalt(2+) disulfamate
When handling Cobalt(2+) disulfamate, it is important to use personal protective equipment (PPE) such as gloves and safety goggles to protect against skin and eye contact. Spills should be handled in a fume hood using appropriate absorbent materials. It is advisable to refer to the Safety Data Sheet (SDS) for detailed guidelines on handling, storage, and emergency procedures.

About

CAS No 14017-41-5
English Name Cobalt(2+) disulfamate
Molecular Formula H4CoN2O6S2
Molecular Weight 251.11 g/mol
SMILES NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Co+2]
InChIKey WLQXLCXXAPYDIU-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cobalt(2+) disulfamate (CAS: 14017-41-5)?

Cobalt(2+) disulfamate is a hydrated salt with a crystalline form. Its molecular weight is approxima...

Compound Q&A

How is Cobalt(2+) disulfamate (CAS: 14017-41-5) typically synthesized?

Cobalt(2+) disulfamate is typically synthesized through the reaction of cobalt(II) salts with sodium...

Compound Q&A

What industries use Cobalt(2+) disulfamate (CAS: 14017-41-5)?

Cobalt(2+) disulfamate is used in various industries due to its unique properties. It is commonly us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...