Compound Q&A

What are the physical and chemical properties of Cobalt(2+) disulfamate (CAS: 14017-41-5)?

Answer

Cobalt(2+) disulfamate
Cobalt(2+) disulfamate is a hydrated salt with a crystalline form. Its molecular weight is approximately 260.16 g/mol. It is soluble in water and less soluble in organic solvents. Chemically, it is stable under normal conditions but can react with strong acids. This compound is used in various applications due to its unique properties.

About

CAS No 14017-41-5
English Name Cobalt(2+) disulfamate
Molecular Formula H4CoN2O6S2
Molecular Weight 251.11 g/mol
SMILES NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Co+2]
InChIKey WLQXLCXXAPYDIU-UHFFFAOYSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Cobalt(2+) disulfamate (CAS: 14017-41-5) typically synthesized?

Cobalt(2+) disulfamate is typically synthesized through the reaction of cobalt(II) salts with sodium...

Compound Q&A

What industries use Cobalt(2+) disulfamate (CAS: 14017-41-5)?

Cobalt(2+) disulfamate is used in various industries due to its unique properties. It is commonly us...

Compound Q&A

What precautions should be taken when handling Cobalt(2+) disulfamate (CAS: 14017-41-5)?

When handling Cobalt(2+) disulfamate, it is important to use personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...