Compound Q&A

In what industries is Hypocrellin B (CAS: 123940-54-5) used?

Answer

Hypocrellin B
Hypocrellin B (CAS: 123940-54-5) is primarily used in the pharmaceutical industry for photodynamic therapy applications. It is also utilized in the polymer industry for its photochemical properties, and in the sensor industry for its photoluminescent characteristics. Additionally, it is explored for its potential in semiconductor applications.

About

English Name Hypocrellin B
Molecular Formula C30H24O9
Molecular Weight 528.5130000000004 g/mol
SMILES CC1=C(C2=C3C4=C(C1)C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(=O)C
InChIKey RMKASJPDEIDZMG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hypocrellin B (CAS: 123940-54-5)?

Hypocrellin B (CAS: 123940-54-5) is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is Hypocrellin B (CAS: 123940-54-5) typically synthesized?

Hypocrellin B (CAS: 123940-54-5) is typically synthesized through a multistep process involving the ...

Compound Q&A

What precautions should be taken when handling Hypocrellin B (CAS: 123940-54-5)?

When handling Hypocrellin B (CAS: 123940-54-5), it is essential to wear appropriate personal protect...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...