Compound Q&A

What are the physical and chemical properties of Hypocrellin B (CAS: 123940-54-5)?

Answer

Hypocrellin B
Hypocrellin B (CAS: 123940-54-5) is a crystalline compound with a molecular weight of approximately 600 g/mol. It is sparingly soluble in water but highly soluble in organic solvents such as ethanol and acetone. Hypocrellin B is relatively stable under normal conditions but can react with strong reducing agents. Its excitation and emission spectra make it useful in photodynamic therapy applications.

About

English Name Hypocrellin B
Molecular Formula C30H24O9
Molecular Weight 528.5130000000004 g/mol
SMILES CC1=C(C2=C3C4=C(C1)C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(=O)C
InChIKey RMKASJPDEIDZMG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Hypocrellin B (CAS: 123940-54-5) typically synthesized?

Hypocrellin B (CAS: 123940-54-5) is typically synthesized through a multistep process involving the ...

Compound Q&A

In what industries is Hypocrellin B (CAS: 123940-54-5) used?

Hypocrellin B (CAS: 123940-54-5) is primarily used in the pharmaceutical industry for photodynamic t...

Compound Q&A

What precautions should be taken when handling Hypocrellin B (CAS: 123940-54-5)?

When handling Hypocrellin B (CAS: 123940-54-5), it is essential to wear appropriate personal protect...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...