Compound Q&A

What are the physical and chemical properties of Hypocrellin B (CAS: 123940-54-5)?

Answer

Hypocrellin B
Hypocrellin B (CAS: 123940-54-5) is a crystalline compound with a molecular weight of approximately 600 g/mol. It is sparingly soluble in water but highly soluble in organic solvents such as ethanol and acetone. Hypocrellin B is relatively stable under normal conditions but can react with strong reducing agents. Its excitation and emission spectra make it useful in photodynamic therapy applications.

About

English Name Hypocrellin B
Molecular Formula C30H24O9
Molecular Weight 528.51 g/mol
SMILES CC1=C(C2=C3C4=C(C1)C(=C(C5=C4C(=C6C3=C(C(=O)C=C6OC)C(=C2OC)O)C(=CC5=O)OC)O)OC)C(=O)C
InChIKey RMKASJPDEIDZMG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Hypocrellin B (CAS: 123940-54-5) typically synthesized?

Hypocrellin B (CAS: 123940-54-5) is typically synthesized through a multistep process involving the ...

Compound Q&A

In what industries is Hypocrellin B (CAS: 123940-54-5) used?

Hypocrellin B (CAS: 123940-54-5) is primarily used in the pharmaceutical industry for photodynamic t...

Compound Q&A

What precautions should be taken when handling Hypocrellin B (CAS: 123940-54-5)?

When handling Hypocrellin B (CAS: 123940-54-5), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...