Compound Q&A

What industries use 3-Fluoro-2-nitropyridine (CAS: 54231-35-5)?

Answer

3-Fluoro-2-nitropyridine
3-Fluoro-2-nitropyridine (CAS: 54231-35-5) is used in various industries, including pharmaceuticals for the synthesis of certain medicinal compounds, and in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 54231-35-5
English Name 3-Fluoro-2-nitropyridine
Molecular Formula C5H3FN2O2
Molecular Weight 142.09 g/mol
SMILES C1=CC(=C(N=C1)[N+](=O)[O-])F
InChIKey IJVFHCSUEBAAOZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-2-nitropyridine (CAS: 54231-35-5)?

3-Fluoro-2-nitropyridine (CAS: 54231-35-5) is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 3-Fluoro-2-nitropyridine (CAS: 54231-35-5) typically synthesized?

3-Fluoro-2-nitropyridine is typically synthesized via the nitration of 2-fluoropyridine. This proces...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-2-nitropyridine (CAS: 54231-35-5)?

When handling 3-Fluoro-2-nitropyridine (CAS: 54231-35-5), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...