Compound Q&A

How is 3-Fluoro-2-nitropyridine (CAS: 54231-35-5) typically synthesized?

Answer

3-Fluoro-2-nitropyridine
3-Fluoro-2-nitropyridine is typically synthesized via the nitration of 2-fluoropyridine. This process involves treating 2-fluoropyridine with a nitration reagent such as fuming sulfuric acid and nitric acid in the presence of a suitable solvent. The reaction is carried out under controlled conditions to achieve high selectivity and yield.

About

CAS No 54231-35-5
English Name 3-Fluoro-2-nitropyridine
Molecular Formula C5H3FN2O2
Molecular Weight 142.09 g/mol
SMILES C1=CC(=C(N=C1)[N+](=O)[O-])F
InChIKey IJVFHCSUEBAAOZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluoro-2-nitropyridine (CAS: 54231-35-5)?

3-Fluoro-2-nitropyridine (CAS: 54231-35-5) is a crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 3-Fluoro-2-nitropyridine (CAS: 54231-35-5)?

3-Fluoro-2-nitropyridine (CAS: 54231-35-5) is used in various industries, including pharmaceuticals ...

Compound Q&A

What precautions should be taken when handling 3-Fluoro-2-nitropyridine (CAS: 54231-35-5)?

When handling 3-Fluoro-2-nitropyridine (CAS: 54231-35-5), it is essential to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...