Compound Q&A

What industries use Perfluorotriethylamine (CAS: 359-70-6)?

Answer

Perfluorotriethylamine
Perfluorotriethylamine (CAS 359-70-6) is used in various industries, including pharmaceuticals for complex organic synthesis, polymers for functionalization and modification, sensors for detecting certain gases, and semiconductors for etching processes and chemical vapor deposition. Its unique properties make it valuable in these applications for its stability and reactivity.

About

CAS No 359-70-6
English Name Perfluorotriethylamine
Molecular Formula N(C2F5)3
Molecular Weight 371.04 g/mol
SMILES C(C(F)(F)F)(N(C(C(F)(F)F)(F)F)C(C(F)(F)F)(F)F)(F)F
InChIKey CBEFDCMSEZEGCX-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Perfluorotriethylamine (CAS: 359-70-6)?

Perfluorotriethylamine (CAS 359-70-6) is a colorless, odorless liquid with a molecular weight of app...

Compound Q&A

How is Perfluorotriethylamine (CAS: 359-70-6) typically synthesized?

Perfluorotriethylamine (CAS 359-70-6) is typically synthesized using a reaction between triethylamin...

Compound Q&A

What precautions should be taken when handling Perfluorotriethylamine (CAS: 359-70-6)?

When handling Perfluorotriethylamine (CAS 359-70-6), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...