Compound Q&A

How is Perfluorotriethylamine (CAS: 359-70-6) typically synthesized?

Answer

Perfluorotriethylamine
Perfluorotriethylamine (CAS 359-70-6) is typically synthesized using a reaction between triethylamine and hexafluoroisopropanol. The process involves the conversion of triethylamine to its trifluoromethylated derivative, followed by addition of the trifluoromethylated reagent to the remaining triethylamine. This method provides a high yield and good selectivity, though detailed reaction conditions and catalysts are necessary for optimal results.

About

CAS No 359-70-6
English Name Perfluorotriethylamine
Molecular Formula N(C2F5)3
Molecular Weight 371.04 g/mol
SMILES C(C(F)(F)F)(N(C(C(F)(F)F)(F)F)C(C(F)(F)F)(F)F)(F)F
InChIKey CBEFDCMSEZEGCX-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Perfluorotriethylamine (CAS: 359-70-6)?

Perfluorotriethylamine (CAS 359-70-6) is a colorless, odorless liquid with a molecular weight of app...

Compound Q&A

What industries use Perfluorotriethylamine (CAS: 359-70-6)?

Perfluorotriethylamine (CAS 359-70-6) is used in various industries, including pharmaceuticals for c...

Compound Q&A

What precautions should be taken when handling Perfluorotriethylamine (CAS: 359-70-6)?

When handling Perfluorotriethylamine (CAS 359-70-6), it is crucial to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...