Compound Q&A

How is Diphenyl phosphonate (CAS: 4712-55-4) typically synthesized?

Answer

Diphenyl phosphonate
Diphenyl phosphonate (CAS: 4712-55-4) is typically synthesized by the reaction of phosphorus oxychloride with diphenyl ketone in the presence of a base such as pyridine. The reaction involves the deprotonation of the ketone followed by the phosphonation of the resulting phenoxide ion. The yield is generally high, and the method is selective for the desired product.

About

CAS No 4712-55-4
English Name Diphenyl phosphonate
Molecular Formula C12H11O3P
Molecular Weight 234.19 g/mol
SMILES C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2
InChIKey OGBPILLJZSJJRC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenyl phosphonate (CAS: 4712-55-4)?

Diphenyl phosphonate (CAS: 4712-55-4) is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use Diphenyl phosphonate (CAS: 4712-55-4)?

Diphenyl phosphonate (CAS: 4712-55-4) is used in a variety of industries, including pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling Diphenyl phosphonate (CAS: 4712-55-4)?

When handling Diphenyl phosphonate (CAS: 4712-55-4), it is important to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...