Compound Q&A

What are the physical and chemical properties of Diphenyl phosphonate (CAS: 4712-55-4)?

Answer

Diphenyl phosphonate
Diphenyl phosphonate (CAS: 4712-55-4) is a crystalline solid with a molecular weight of approximately 194.22 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles, making it useful in various synthetic applications. Its reactivity is due to the phosphonate functionality, which can participate in nucleophilic substitution reactions.

About

CAS No 4712-55-4
English Name Diphenyl phosphonate
Molecular Formula C12H11O3P
Molecular Weight 234.19 g/mol
SMILES C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2
InChIKey OGBPILLJZSJJRC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Diphenyl phosphonate (CAS: 4712-55-4) typically synthesized?

Diphenyl phosphonate (CAS: 4712-55-4) is typically synthesized by the reaction of phosphorus oxychlo...

Compound Q&A

What industries use Diphenyl phosphonate (CAS: 4712-55-4)?

Diphenyl phosphonate (CAS: 4712-55-4) is used in a variety of industries, including pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling Diphenyl phosphonate (CAS: 4712-55-4)?

When handling Diphenyl phosphonate (CAS: 4712-55-4), it is important to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...