Compound Q&A

What are the physical and chemical properties of (1S,3S,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8lambda5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride (CAS: 10405-02-4)?

Answer

(1S,3S,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8lambda5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride
This compound is a crystalline solid with a molecular weight of approximately 664.4 g/mol. It has a low solubility in water and good solubility in organic solvents like dichloromethane and methanol. It is highly reactive towards nucleophiles and bases. The compound is stable under normal conditions but should be stored in a cool, dry place away from strong acids and bases.

About

CAS No 10405-02-4
English Name (1S,3S,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8lambda5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride
Molecular Formula C25H30ClNO3
Molecular Weight 428 g/mol
SMILES C1CC[N+]2(C1)C3CCC2CC(C3)OC(=O)C(C4=CC=CC=C4)(C5=CC=CC=C5)O.[Cl-]
InChIKey RVCSYOQWLPPAOA-DHWZJIOFSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (1S,3S,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8lambda5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride (CAS: 10405-02-4) typically synthesized?

This compound can be synthesized via a multi-step process involving the formation of a key ester, fo...

Compound Q&A

What industries use (1S,3S,5R)-3-[(2-hydroxy-2,2-diphenylacetyl)oxy]-8lambda5-azaspiro[bicyclo[3.2.1]octane-8,1'-pyrrolidin]-8-ylium chloride (CAS: 10405-02-4)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate, particul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...