Compound Q&A

How is Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3) typically synthesized?

Answer

Chymotrypsin Substrate I, Colorimetric
Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3) is synthesized by coupling a chromogenic amino acid derivative to a chymotrypsin recognition motif. Commonly, this involves using a protected amino acid and a coupling reagent such as N,N′-carbodiimide in the presence of a suitable catalyst to achieve high yield and selectivity.

About

CAS No 9004-07-3
English Name Chymotrypsin Substrate I, Colorimetric
Molecular Formula C23H25N5O8
Molecular Weight 499.47 g/mol
SMILES C1=CC=C(C=C1)CC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CNC(=O)CNC(=O)CCC(=O)O
InChIKey CFYIUBWVKZQDOG-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3)?

Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3) is a crystalline compound with a molecular w...

Compound Q&A

What industries use Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3)?

Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3) is widely used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3)?

When handling Chymotrypsin Substrate I, Colorimetric (CAS: 9004-07-3), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...