Compound Q&A

What industries use (-)-10,2-Camphorsultam (CAS: 94594-90-8)?

Answer

(-)-10,2-Camphorsultam
(-)-10,2-Camphorsultam is primarily used in the pharmaceutical industry for the synthesis of chiral intermediates and drugs. It is also utilized in the polymer industry for the development of special polymers with unique properties. Additionally, it finds applications in the semiconductors and sensors industry due to its chiral nature and potential for use in chiral recognition and separation processes.

About

CAS No 94594-90-8
English Name (-)-10,2-Camphorsultam
Molecular Formula C10H17NO2S
Molecular Weight 215.318 g/mol
SMILES CC1(C2CCC13CS(=O)(=O)NC3C2)C
InChIKey DPJYJNYYDJOJNO-OYNCUSHFSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (-)-10,2-Camphorsultam (CAS: 94594-90-8)?

(-)-10,2-Camphorsultam is a crystalline compound with a molecular weight of approximately 274.41 g/m...

Compound Q&A

How is (-)-10,2-Camphorsultam (CAS: 94594-90-8) typically synthesized?

(-)-10,2-Camphorsultam is synthesized using a stereoselective method, often employing a chiral auxil...

Compound Q&A

What precautions should be taken when handling (-)-10,2-Camphorsultam (CAS: 94594-90-8)?

When handling (-)-10,2-Camphorsultam, appropriate personal protective equipment (PPE) should be worn...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...