Compound Q&A

How is (-)-10,2-Camphorsultam (CAS: 94594-90-8) typically synthesized?

Answer

(-)-10,2-Camphorsultam
(-)-10,2-Camphorsultam is synthesized using a stereoselective method, often employing a chiral auxillary and asymmetric catalysis. The synthesis involves a multistep process including esterification, ring closure, and sultam formation. The yield is typically around 70-80%, and the process requires precise control of reaction conditions to achieve high stereoselectivity.

About

CAS No 94594-90-8
English Name (-)-10,2-Camphorsultam
Molecular Formula C10H17NO2S
Molecular Weight 215.32 g/mol
SMILES CC1(C2CCC13CS(=O)(=O)NC3C2)C
InChIKey DPJYJNYYDJOJNO-OYNCUSHFSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (-)-10,2-Camphorsultam (CAS: 94594-90-8)?

(-)-10,2-Camphorsultam is a crystalline compound with a molecular weight of approximately 274.41 g/m...

Compound Q&A

What industries use (-)-10,2-Camphorsultam (CAS: 94594-90-8)?

(-)-10,2-Camphorsultam is primarily used in the pharmaceutical industry for the synthesis of chiral ...

Compound Q&A

What precautions should be taken when handling (-)-10,2-Camphorsultam (CAS: 94594-90-8)?

When handling (-)-10,2-Camphorsultam, appropriate personal protective equipment (PPE) should be worn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...