Compound Q&A

What precautions should be taken when handling 1-Nitro-9,10-anthraquinone (CAS: 82-34-8)?

Answer

1-Nitro-9,10-anthraquinone
When handling 1-Nitro-9,10-anthraquinone, it is essential to wear appropriate personal protective equipment (PPE), including safety goggles, gloves, and lab coats, to prevent skin contact and inhalation of dust. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. Spills should be cleaned up using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the safety data sheet (SDS) for detailed handling and disposal information.

About

CAS No 82-34-8
English Name 1-Nitro-9,10-anthraquinone
Molecular Formula C14H7NO4
Molecular Weight 253.21 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)[N+](=O)[O-]
InChIKey YCANAXVBJKNANM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Nitro-9,10-anthraquinone (CAS: 82-34-8)?

1-Nitro-9,10-anthraquinone is a crystalline solid with a molecular weight of approximately 254.08 g/...

Compound Q&A

How is 1-Nitro-9,10-anthraquinone (CAS: 82-34-8) typically synthesized?

1-Nitro-9,10-anthraquinone is typically synthesized through the nitration of 9,10-anthraquinone usin...

Compound Q&A

What industries use 1-Nitro-9,10-anthraquinone (CAS: 82-34-8)?

1-Nitro-9,10-anthraquinone is used in various industries, particularly in the production of dyes and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...