Compound Q&A

What industries use 1-Nitro-9,10-anthraquinone (CAS: 82-34-8)?

Answer

1-Nitro-9,10-anthraquinone
1-Nitro-9,10-anthraquinone is used in various industries, particularly in the production of dyes and pigments. It is also employed in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. Additionally, it finds applications in the polymer industry for the preparation of colorant masterbatches and in the manufacturing of sensors and semiconductors.

About

CAS No 82-34-8
English Name 1-Nitro-9,10-anthraquinone
Molecular Formula C14H7NO4
Molecular Weight 253.21 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)[N+](=O)[O-]
InChIKey YCANAXVBJKNANM-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Nitro-9,10-anthraquinone (CAS: 82-34-8)?

1-Nitro-9,10-anthraquinone is a crystalline solid with a molecular weight of approximately 254.08 g/...

Compound Q&A

How is 1-Nitro-9,10-anthraquinone (CAS: 82-34-8) typically synthesized?

1-Nitro-9,10-anthraquinone is typically synthesized through the nitration of 9,10-anthraquinone usin...

Compound Q&A

What precautions should be taken when handling 1-Nitro-9,10-anthraquinone (CAS: 82-34-8)?

When handling 1-Nitro-9,10-anthraquinone, it is essential to wear appropriate personal protective eq...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...