Compound Q&A

What are the physical and chemical properties of 5-Chloro-2,3-diphenylpyrazine (CAS: 41270-66-0)?

Answer

5-Chloro-2,3-diphenylpyrazine
5-Chloro-2,3-diphenylpyrazine is a solid with a crystalline form. Its molecular weight is approximately 313.77 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and dichloromethane. The compound is relatively stable under normal conditions but can react with strong acids and bases. It is less reactive towards electrophiles but can undergo substitution reactions under appropriate conditions.

About

CAS No 41270-66-0
English Name 5-Chloro-2,3-diphenylpyrazine
Molecular Formula C16H11ClN2
Molecular Weight 266.73 g/mol
SMILES C1=CC=C(C=C1)C2=NC=C(N=C2C3=CC=CC=C3)Cl
InChIKey VUGNCPVAXWZTOL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 5-Chloro-2,3-diphenylpyrazine (CAS: 41270-66-0) typically synthesized?

5-Chloro-2,3-diphenylpyrazine is typically synthesized through a multi-step process involving the co...

Compound Q&A

What industries use 5-Chloro-2,3-diphenylpyrazine (CAS: 41270-66-0)?

5-Chloro-2,3-diphenylpyrazine is primarily used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2,3-diphenylpyrazine (CAS: 41270-66-0)?

When handling 5-Chloro-2,3-diphenylpyrazine, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...