Compound Q&A

How is Aripiprazole Impurity 31 (CAS: 19315-93-6) typically synthesized?

Answer

Aripiprazole Impurity 31 (2,6-quinolinediol)
Aripiprazole Impurity 31 is synthesized through the reduction of 1,2-dihydro-2,6-dimethyl-3-(1,3-dioxoisoindolin-2-yl) quinoline with a hydrogenation catalyst such as palladium on carbon. The reaction typically requires high purity starting materials and is conducted in an inert atmosphere to prevent oxidation. The yield is usually around 85-90%, and the process is optimized for selectivity and purity.

About

CAS No 19315-93-6
English Name Aripiprazole Impurity 31 (2,6-quinolinediol)
Molecular Formula C9H7NO2
Molecular Weight 161.16 g/mol
SMILES C1=CC2=C(C=CC(=O)N2)C=C1O
InChIKey AQLYZDRHNHZHIS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aripiprazole Impurity 31 (CAS: 19315-93-6)?

Aripiprazole Impurity 31, also known as 2,6-quinolinediol, is a crystalline compound with a molecula...

Compound Q&A

What industries use Aripiprazole Impurity 31 (CAS: 19315-93-6)?

Aripiprazole Impurity 31 is primarily used in the pharmaceutical industry as a by-product or impurit...

Compound Q&A

What precautions should be taken when handling Aripiprazole Impurity 31 (CAS: 19315-93-6)?

When handling Aripiprazole Impurity 31, it is crucial to use appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...